About 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid
3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid (PubChem CID 115086428) has the molecular formula C12H17NO5S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid |
| PubChem CID | 115086428 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid |
| SMILES | O=C(O)CCc1cnc(CC2CCCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C12H17NO5S/c14-12(15)4-3-10-7-13-11(18-10)6-9-2-1-5-19(16,17)8-9/h7,9H,1-6,8H2,(H,14,15) |
| InChIKey | QPMAZXRRNMQVMT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid?
The IUPAC name of 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid (CID 115086428) is 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid?
The canonical SMILES for 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid is O=C(O)CCc1cnc(CC2CCCS(=O)(=O)C2)o1.
What is the InChIKey of 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid?
The InChIKey is QPMAZXRRNMQVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5S/c14-12(15)4-3-10-7-13-11(18-10)6-9-2-1-5-19(16,17)8-9/h7,9H,1-6,8H2,(H,14,15).
What are the key properties of 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid?
3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid has a molecular weight of 287.34 g/mol, XLogP of 1.06, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazol-5-yl]propanoic acid is sourced from PubChem (CID 115086428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).