C10H13NO5S — CID 115085795
3-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-5-yl]propanoic acid (PubChem CID 115085795) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 3-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-5-yl]propanoic acid.
| Compound Name | 3-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 115085795 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-5-yl]propanoic acid |
| SMILES | O=C(O)CCc1cnc(C2CCCS2(=O)=O)o1 |
| InChI | InChI=1S/C10H13NO5S/c12-9(13)4-3-7-6-11-10(16-7)8-2-1-5-17(8,14)15/h6,8H,1-5H2,(H,12,13) |
| InChIKey | SSHCXMQEVMUOEK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |