2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid

C9H11NO5S — CID 115082868

IUPAC2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid
SMILESO=C(O)Cc1coc(C2CCCS2(=O)=O)n1
InChIInChI=1S/C9H11NO5S/c11-8(12)4-6-5-15-9(10-6)7-2-1-3-16(7,13)14/h5,7H,1-4H2,(H,11,12)
InChIKeyDZCIWXYEFQTVIE-UHFFFAOYSA-N
MW245.26 g/mol
LogP0.55
Rot. Bonds3

About 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid

2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 115082868) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid
PubChem CID115082868
Molecular FormulaC9H11NO5S
Molecular Weight245.26 g/mol
Exact Mass245.04
IUPAC Name2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid
SMILESO=C(O)Cc1coc(C2CCCS2(=O)=O)n1
InChIInChI=1S/C9H11NO5S/c11-8(12)4-6-5-15-9(10-6)7-2-1-3-16(7,13)14/h5,7H,1-4H2,(H,11,12)
InChIKeyDZCIWXYEFQTVIE-UHFFFAOYSA-N
XLogP0.55
TPSA97.47 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.26
LogP ≤ 50.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid (CID 115082868) is 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid is O=C(O)Cc1coc(C2CCCS2(=O)=O)n1.
What is the InChIKey of 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid?
The InChIKey is DZCIWXYEFQTVIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5S/c11-8(12)4-6-5-15-9(10-6)7-2-1-3-16(7,13)14/h5,7H,1-4H2,(H,11,12).
What are the key properties of 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid?
2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid has a molecular weight of 245.26 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,1-dioxothiolan-2-yl)-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 115082868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).