C6H6ClNO3 — CID 174696491
2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 174696491) has the molecular formula C6H6ClNO3 and a molecular weight of 175.57 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid.
| Compound Name | 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 174696491 |
| Molecular Formula | C6H6ClNO3 |
| Molecular Weight | 175.57 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1coc(CCl)n1 |
| InChI | InChI=1S/C6H6ClNO3/c7-2-5-8-4(3-11-5)1-6(9)10/h3H,1-2H2,(H,9,10) |
| InChIKey | YUFGTCQVKMBLBP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.57 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|