About 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid
2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 174696491) has the molecular formula C6H6ClNO3
and a molecular weight of 175.57 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid |
| PubChem CID | 174696491 |
| Molecular Formula | C6H6ClNO3 |
| Molecular Weight | 175.57 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1coc(CCl)n1 |
| InChI | InChI=1S/C6H6ClNO3/c7-2-5-8-4(3-11-5)1-6(9)10/h3H,1-2H2,(H,9,10) |
| InChIKey | YUFGTCQVKMBLBP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.57 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid (CID 174696491) is 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid is O=C(O)Cc1coc(CCl)n1.
What is the InChIKey of 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid?
The InChIKey is YUFGTCQVKMBLBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO3/c7-2-5-8-4(3-11-5)1-6(9)10/h3H,1-2H2,(H,9,10).
What are the key properties of 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid?
2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid has a molecular weight of 175.57 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(chloromethyl)-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 174696491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).