C12H11NO4 — CID 82128961
2-[2-(phenoxymethyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 82128961) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-[2-(phenoxymethyl)-1,3-oxazol-4-yl]acetic acid.
| Compound Name | 2-[2-(phenoxymethyl)-1,3-oxazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 82128961 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-[2-(phenoxymethyl)-1,3-oxazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1coc(COc2ccccc2)n1 |
| InChI | InChI=1S/C12H11NO4/c14-12(15)6-9-7-17-11(13-9)8-16-10-4-2-1-3-5-10/h1-5,7H,6,8H2,(H,14,15) |
| InChIKey | CBEVDHDSPODWMX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |