C9H13NO4 — CID 115081943
2-[2-(3-methoxypropyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 115081943) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-[2-(3-methoxypropyl)-1,3-oxazol-4-yl]acetic acid.
| Compound Name | 2-[2-(3-methoxypropyl)-1,3-oxazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 115081943 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-[2-(3-methoxypropyl)-1,3-oxazol-4-yl]acetic acid |
| SMILES | COCCCc1nc(CC(=O)O)co1 |
| InChI | InChI=1S/C9H13NO4/c1-13-4-2-3-8-10-7(6-14-8)5-9(11)12/h6H,2-5H2,1H3,(H,11,12) |
| InChIKey | FZNNPOUUXHAHPP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|