3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid

C14H15NO4 — CID 115084021

IUPAC3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid
SMILESCOc1ccccc1Cc1nc(CCC(=O)O)co1
InChIInChI=1S/C14H15NO4/c1-18-12-5-3-2-4-10(12)8-13-15-11(9-19-13)6-7-14(16)17/h2-5,9H,6-8H2,1H3,(H,16,17)
InChIKeyIKZQGVVWJNRCTR-UHFFFAOYSA-N
MW261.28 g/mol
LogP2.29
Rot. Bonds6

About 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid

3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid (PubChem CID 115084021) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid
PubChem CID115084021
Molecular FormulaC14H15NO4
Molecular Weight261.28 g/mol
Exact Mass261.10
IUPAC Name3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid
SMILESCOc1ccccc1Cc1nc(CCC(=O)O)co1
InChIInChI=1S/C14H15NO4/c1-18-12-5-3-2-4-10(12)8-13-15-11(9-19-13)6-7-14(16)17/h2-5,9H,6-8H2,1H3,(H,16,17)
InChIKeyIKZQGVVWJNRCTR-UHFFFAOYSA-N
XLogP2.29
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.28
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid (CID 115084021) is 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid is COc1ccccc1Cc1nc(CCC(=O)O)co1.
What is the InChIKey of 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid?
The InChIKey is IKZQGVVWJNRCTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-18-12-5-3-2-4-10(12)8-13-15-11(9-19-13)6-7-14(16)17/h2-5,9H,6-8H2,1H3,(H,16,17).
What are the key properties of 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid?
3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid has a molecular weight of 261.28 g/mol, XLogP of 2.29, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2-methoxyphenyl)methyl]-1,3-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 115084021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).