C20H22O5 — CID 67636560
3-[3-(2-carboxyethyl)-5-[(2-methoxyphenyl)methyl]phenyl]propanoic acid (PubChem CID 67636560) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 3-[3-(2-carboxyethyl)-5-[(2-methoxyphenyl)methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethyl)-5-[(2-methoxyphenyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67636560 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-[3-(2-carboxyethyl)-5-[(2-methoxyphenyl)methyl]phenyl]propanoic acid |
| SMILES | COc1ccccc1Cc1cc(CCC(=O)O)cc(CCC(=O)O)c1 |
| InChI | InChI=1S/C20H22O5/c1-25-18-5-3-2-4-17(18)13-16-11-14(6-8-19(21)22)10-15(12-16)7-9-20(23)24/h2-5,10-12H,6-9,13H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | HIQLLOUTXISKQQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |