3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid

C9H13NO4 — CID 115081944

IUPAC3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid
SMILESO=C(O)CCc1coc(CCCO)n1
InChIInChI=1S/C9H13NO4/c11-5-1-2-8-10-7(6-14-8)3-4-9(12)13/h6,11H,1-5H2,(H,12,13)
InChIKeyKKTGYEKJNAFKKH-UHFFFAOYSA-N
MW199.21 g/mol
LogP0.62
Rot. Bonds6

About 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid

3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid (PubChem CID 115081944) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid
PubChem CID115081944
Molecular FormulaC9H13NO4
Molecular Weight199.21 g/mol
Exact Mass199.08
IUPAC Name3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid
SMILESO=C(O)CCc1coc(CCCO)n1
InChIInChI=1S/C9H13NO4/c11-5-1-2-8-10-7(6-14-8)3-4-9(12)13/h6,11H,1-5H2,(H,12,13)
InChIKeyKKTGYEKJNAFKKH-UHFFFAOYSA-N
XLogP0.62
TPSA83.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.21
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid (CID 115081944) is 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid is O=C(O)CCc1coc(CCCO)n1.
What is the InChIKey of 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid?
The InChIKey is KKTGYEKJNAFKKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4/c11-5-1-2-8-10-7(6-14-8)3-4-9(12)13/h6,11H,1-5H2,(H,12,13).
What are the key properties of 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid?
3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid has a molecular weight of 199.21 g/mol, XLogP of 0.62, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid is sourced from PubChem (CID 115081944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).