C9H13NO4 — CID 115081944
3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid (PubChem CID 115081944) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 115081944 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-[2-(3-hydroxypropyl)-1,3-oxazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1coc(CCCO)n1 |
| InChI | InChI=1S/C9H13NO4/c11-5-1-2-8-10-7(6-14-8)3-4-9(12)13/h6,11H,1-5H2,(H,12,13) |
| InChIKey | KKTGYEKJNAFKKH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |