2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid

C10H13NO4 — CID 115027242

IUPAC2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid
SMILESO=C(O)Cc1coc(C2CCOCC2)n1
InChIInChI=1S/C10H13NO4/c12-9(13)5-8-6-15-10(11-8)7-1-3-14-4-2-7/h6-7H,1-5H2,(H,12,13)
InChIKeyNELFMUFCXSOQPJ-UHFFFAOYSA-N
MW211.22 g/mol
LogP1.20
Rot. Bonds3

About 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid

2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 115027242) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid
PubChem CID115027242
Molecular FormulaC10H13NO4
Molecular Weight211.22 g/mol
Exact Mass211.08
IUPAC Name2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid
SMILESO=C(O)Cc1coc(C2CCOCC2)n1
InChIInChI=1S/C10H13NO4/c12-9(13)5-8-6-15-10(11-8)7-1-3-14-4-2-7/h6-7H,1-5H2,(H,12,13)
InChIKeyNELFMUFCXSOQPJ-UHFFFAOYSA-N
XLogP1.20
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.22
LogP ≤ 51.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid (CID 115027242) is 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid is O=C(O)Cc1coc(C2CCOCC2)n1.
What is the InChIKey of 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid?
The InChIKey is NELFMUFCXSOQPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c12-9(13)5-8-6-15-10(11-8)7-1-3-14-4-2-7/h6-7H,1-5H2,(H,12,13).
What are the key properties of 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid?
2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid has a molecular weight of 211.22 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(oxan-4-yl)-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 115027242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).