C9H11NO5S — CID 115045543
2-[2-(1,1-dioxothiolan-3-yl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 115045543) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-[2-(1,1-dioxothiolan-3-yl)-1,3-oxazol-4-yl]acetic acid.
| Compound Name | 2-[2-(1,1-dioxothiolan-3-yl)-1,3-oxazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 115045543 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-[2-(1,1-dioxothiolan-3-yl)-1,3-oxazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1coc(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C9H11NO5S/c11-8(12)3-7-4-15-9(10-7)6-1-2-16(13,14)5-6/h4,6H,1-3,5H2,(H,11,12) |
| InChIKey | QTHQILYFEWALOZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |