C10H13NO4S — CID 115082603
1-[2-(1,1-dioxothian-3-yl)-1,3-oxazol-4-yl]ethanone (PubChem CID 115082603) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothian-3-yl)-1,3-oxazol-4-yl]ethanone.
| Compound Name | 1-[2-(1,1-dioxothian-3-yl)-1,3-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 115082603 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-[2-(1,1-dioxothian-3-yl)-1,3-oxazol-4-yl]ethanone |
| SMILES | CC(=O)c1coc(C2CCCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H13NO4S/c1-7(12)9-5-15-10(11-9)8-3-2-4-16(13,14)6-8/h5,8H,2-4,6H2,1H3 |
| InChIKey | QDDFIMIOLRHMRM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |