C10H16N2O3S — CID 115085576
1-[2-(1,1-dioxothian-3-yl)-1,3-oxazol-5-yl]ethanamine (PubChem CID 115085576) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothian-3-yl)-1,3-oxazol-5-yl]ethanamine.
| Compound Name | 1-[2-(1,1-dioxothian-3-yl)-1,3-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 115085576 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-[2-(1,1-dioxothian-3-yl)-1,3-oxazol-5-yl]ethanamine |
| SMILES | CC(N)c1cnc(C2CCCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C10H16N2O3S/c1-7(11)9-5-12-10(15-9)8-3-2-4-16(13,14)6-8/h5,7-8H,2-4,6,11H2,1H3 |
| InChIKey | GPNDWAHDCHJECN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |