C9H14N2O3S — CID 115084978
1-[2-(1,1-dioxothiolan-3-yl)-1,3-oxazol-5-yl]ethanamine (PubChem CID 115084978) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothiolan-3-yl)-1,3-oxazol-5-yl]ethanamine.
| Compound Name | 1-[2-(1,1-dioxothiolan-3-yl)-1,3-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 115084978 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-[2-(1,1-dioxothiolan-3-yl)-1,3-oxazol-5-yl]ethanamine |
| SMILES | CC(N)c1cnc(C2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C9H14N2O3S/c1-6(10)8-4-11-9(14-8)7-2-3-15(12,13)5-7/h4,6-7H,2-3,5,10H2,1H3 |
| InChIKey | WFBGWJMLCJKATE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |