C11H16N2O3S — CID 115047827
3-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)thiolane 1,1-dioxide (PubChem CID 115047827) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 115047827 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2cnc(C3CCCN3)o2)C1 |
| InChI | InChI=1S/C11H16N2O3S/c14-17(15)5-3-8(7-17)10-6-13-11(16-10)9-2-1-4-12-9/h6,8-9,12H,1-5,7H2 |
| InChIKey | VBIBBYIYVLXQSB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |