C16H20N2O — CID 82049611
2-pyrrolidin-2-yl-5-(2,4,6-trimethylphenyl)-1,3-oxazole (PubChem CID 82049611) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-5-(2,4,6-trimethylphenyl)-1,3-oxazole.
| Compound Name | 2-pyrrolidin-2-yl-5-(2,4,6-trimethylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 82049611 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-pyrrolidin-2-yl-5-(2,4,6-trimethylphenyl)-1,3-oxazole |
| SMILES | Cc1cc(C)c(-c2cnc(C3CCCN3)o2)c(C)c1 |
| InChI | InChI=1S/C16H20N2O/c1-10-7-11(2)15(12(3)8-10)14-9-18-16(19-14)13-5-4-6-17-13/h7-9,13,17H,4-6H2,1-3H3 |
| InChIKey | UUZSDABZFPVPAW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |