C9H14N2O2 — CID 115085656
1-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)ethanol (PubChem CID 115085656) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)ethanol.
| Compound Name | 1-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)ethanol |
|---|---|
| PubChem CID | 115085656 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(2-pyrrolidin-2-yl-1,3-oxazol-5-yl)ethanol |
| SMILES | CC(O)c1cnc(C2CCCN2)o1 |
| InChI | InChI=1S/C9H14N2O2/c1-6(12)8-5-11-9(13-8)7-3-2-4-10-7/h5-7,10,12H,2-4H2,1H3 |
| InChIKey | WFWDTYKBZWIXSH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |