C10H15NO2S — CID 115085513
1-[2-(thian-3-yl)-1,3-oxazol-5-yl]ethanol (PubChem CID 115085513) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 1-[2-(thian-3-yl)-1,3-oxazol-5-yl]ethanol.
| Compound Name | 1-[2-(thian-3-yl)-1,3-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115085513 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-[2-(thian-3-yl)-1,3-oxazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(C2CCCSC2)o1 |
| InChI | InChI=1S/C10H15NO2S/c1-7(12)9-5-11-10(13-9)8-3-2-4-14-6-8/h5,7-8,12H,2-4,6H2,1H3 |
| InChIKey | HLPZTHGISMTPFK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |