C11H17NO2 — CID 115087436
2-(2-cyclopentyl-1,3-oxazol-5-yl)propan-1-ol (PubChem CID 115087436) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(2-cyclopentyl-1,3-oxazol-5-yl)propan-1-ol.
| Compound Name | 2-(2-cyclopentyl-1,3-oxazol-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 115087436 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(2-cyclopentyl-1,3-oxazol-5-yl)propan-1-ol |
| SMILES | CC(CO)c1cnc(C2CCCC2)o1 |
| InChI | InChI=1S/C11H17NO2/c1-8(7-13)10-6-12-11(14-10)9-4-2-3-5-9/h6,8-9,13H,2-5,7H2,1H3 |
| InChIKey | OOERHWRHNAZPJB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |