C12H19NO2 — CID 115084637
2-(2-cyclohexyl-1,3-oxazol-4-yl)propan-1-ol (PubChem CID 115084637) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,3-oxazol-4-yl)propan-1-ol.
| Compound Name | 2-(2-cyclohexyl-1,3-oxazol-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 115084637 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-(2-cyclohexyl-1,3-oxazol-4-yl)propan-1-ol |
| SMILES | CC(CO)c1coc(C2CCCCC2)n1 |
| InChI | InChI=1S/C12H19NO2/c1-9(7-14)11-8-15-12(13-11)10-5-3-2-4-6-10/h8-10,14H,2-7H2,1H3 |
| InChIKey | PIOREQVPZZKNJD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |