C10H15NO3 — CID 115082044
2-[2-(oxolan-3-yl)-1,3-oxazol-4-yl]propan-1-ol (PubChem CID 115082044) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-[2-(oxolan-3-yl)-1,3-oxazol-4-yl]propan-1-ol.
| Compound Name | 2-[2-(oxolan-3-yl)-1,3-oxazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 115082044 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-[2-(oxolan-3-yl)-1,3-oxazol-4-yl]propan-1-ol |
| SMILES | CC(CO)c1coc(C2CCOC2)n1 |
| InChI | InChI=1S/C10H15NO3/c1-7(4-12)9-6-14-10(11-9)8-2-3-13-5-8/h6-8,12H,2-5H2,1H3 |
| InChIKey | DHWHASWQUXEKED-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |