C11H16N2O — CID 105446346
5-(azetidin-3-yl)-2-cyclopentyl-1,3-oxazole (PubChem CID 105446346) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-(azetidin-3-yl)-2-cyclopentyl-1,3-oxazole.
| Compound Name | 5-(azetidin-3-yl)-2-cyclopentyl-1,3-oxazole |
|---|---|
| PubChem CID | 105446346 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 5-(azetidin-3-yl)-2-cyclopentyl-1,3-oxazole |
| SMILES | c1nc(C2CCCC2)oc1C1CNC1 |
| InChI | InChI=1S/C11H16N2O/c1-2-4-8(3-1)11-13-7-10(14-11)9-5-12-6-9/h7-9,12H,1-6H2 |
| InChIKey | NMTAXPLGZGUPMR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |