C11H16N2O2 — CID 115025820
2-(azetidin-3-yl)-5-(oxan-4-yl)-1,3-oxazole (PubChem CID 115025820) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-5-(oxan-4-yl)-1,3-oxazole.
| Compound Name | 2-(azetidin-3-yl)-5-(oxan-4-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 115025820 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(azetidin-3-yl)-5-(oxan-4-yl)-1,3-oxazole |
| SMILES | c1nc(C2CNC2)oc1C1CCOCC1 |
| InChI | InChI=1S/C11H16N2O2/c1-3-14-4-2-8(1)10-7-13-11(15-10)9-5-12-6-9/h7-9,12H,1-6H2 |
| InChIKey | HGNOPHNFOQIOQG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |