C13H20N2O — CID 84685995
5-cyclohexyl-2-pyrrolidin-3-yl-1,3-oxazole (PubChem CID 84685995) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-cyclohexyl-2-pyrrolidin-3-yl-1,3-oxazole.
| Compound Name | 5-cyclohexyl-2-pyrrolidin-3-yl-1,3-oxazole |
|---|---|
| PubChem CID | 84685995 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 5-cyclohexyl-2-pyrrolidin-3-yl-1,3-oxazole |
| SMILES | c1nc(C2CCNC2)oc1C1CCCCC1 |
| InChI | InChI=1S/C13H20N2O/c1-2-4-10(5-3-1)12-9-15-13(16-12)11-6-7-14-8-11/h9-11,14H,1-8H2 |
| InChIKey | SLRUKJPDYTVENM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |