C13H14N2O2 — CID 84693433
2-(2-pyrrolidin-3-yl-1,3-oxazol-5-yl)phenol (PubChem CID 84693433) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(2-pyrrolidin-3-yl-1,3-oxazol-5-yl)phenol.
| Compound Name | 2-(2-pyrrolidin-3-yl-1,3-oxazol-5-yl)phenol |
|---|---|
| PubChem CID | 84693433 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-(2-pyrrolidin-3-yl-1,3-oxazol-5-yl)phenol |
| SMILES | Oc1ccccc1-c1cnc(C2CCNC2)o1 |
| InChI | InChI=1S/C13H14N2O2/c16-11-4-2-1-3-10(11)12-8-15-13(17-12)9-5-6-14-7-9/h1-4,8-9,14,16H,5-7H2 |
| InChIKey | NRCTZZZGPJIWNU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |