About 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde
2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde (PubChem CID 115085525) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde |
| PubChem CID | 115085525 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C2CCCNC2)o1 |
| InChI | InChI=1S/C9H12N2O2/c12-6-8-5-11-9(13-8)7-2-1-3-10-4-7/h5-7,10H,1-4H2 |
| InChIKey | YHXOECNSSOAFPD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde?
The IUPAC name of 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde (CID 115085525) is 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde.
What is the SMILES notation for 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde?
The canonical SMILES for 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde is O=Cc1cnc(C2CCCNC2)o1.
What is the InChIKey of 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde?
The InChIKey is YHXOECNSSOAFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c12-6-8-5-11-9(13-8)7-2-1-3-10-4-7/h5-7,10H,1-4H2.
What are the key properties of 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde?
2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde has a molecular weight of 180.21 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde is sourced from PubChem (CID 115085525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).