C9H12N2O2 — CID 115085525
2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde (PubChem CID 115085525) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde.
| Compound Name | 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 115085525 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-piperidin-3-yl-1,3-oxazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C2CCCNC2)o1 |
| InChI | InChI=1S/C9H12N2O2/c12-6-8-5-11-9(13-8)7-2-1-3-10-4-7/h5-7,10H,1-4H2 |
| InChIKey | YHXOECNSSOAFPD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|