C8H11N3O2 — CID 82668755
5-piperidin-3-yl-1,3,4-oxadiazole-2-carbaldehyde (PubChem CID 82668755) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 5-piperidin-3-yl-1,3,4-oxadiazole-2-carbaldehyde.
| Compound Name | 5-piperidin-3-yl-1,3,4-oxadiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 82668755 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5-piperidin-3-yl-1,3,4-oxadiazole-2-carbaldehyde |
| SMILES | O=Cc1nnc(C2CCCNC2)o1 |
| InChI | InChI=1S/C8H11N3O2/c12-5-7-10-11-8(13-7)6-2-1-3-9-4-6/h5-6,9H,1-4H2 |
| InChIKey | SJDQBTPMHLVBFO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|