C9H13N3O3 — CID 105464818
methyl 5-piperidin-3-yl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 105464818) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 5-piperidin-3-yl-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | methyl 5-piperidin-3-yl-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 105464818 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | methyl 5-piperidin-3-yl-1,3,4-oxadiazole-2-carboxylate |
| SMILES | COC(=O)c1nnc(C2CCCNC2)o1 |
| InChI | InChI=1S/C9H13N3O3/c1-14-9(13)8-12-11-7(15-8)6-3-2-4-10-5-6/h6,10H,2-5H2,1H3 |
| InChIKey | ZMPUPWBJUWDHJL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |