C12H18N4O — CID 5255005
2-piperidin-3-yl-5-(1,2,3,6-tetrahydropyridin-3-yl)-1,3,4-oxadiazole (PubChem CID 5255005) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-piperidin-3-yl-5-(1,2,3,6-tetrahydropyridin-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-piperidin-3-yl-5-(1,2,3,6-tetrahydropyridin-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 5255005 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-piperidin-3-yl-5-(1,2,3,6-tetrahydropyridin-3-yl)-1,3,4-oxadiazole |
| SMILES | C1=CC(c2nnc(C3CCCNC3)o2)CNC1 |
| InChI | InChI=1S/C12H18N4O/c1-3-9(7-13-5-1)11-15-16-12(17-11)10-4-2-6-14-8-10/h1,3,9-10,13-14H,2,4-8H2 |
| InChIKey | UAXRVAKSZDJJML-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|