C15H17ClN2O — CID 97357376
5-[(4-chlorophenyl)methyl]-2-[(3S)-piperidin-3-yl]-1,3-oxazole (PubChem CID 97357376) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-2-[(3S)-piperidin-3-yl]-1,3-oxazole.
| Compound Name | 5-[(4-chlorophenyl)methyl]-2-[(3S)-piperidin-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 97357376 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-2-[(3S)-piperidin-3-yl]-1,3-oxazole |
| SMILES | Clc1ccc(Cc2cnc([C@H]3CCCNC3)o2)cc1 |
| InChI | InChI=1S/C15H17ClN2O/c16-13-5-3-11(4-6-13)8-14-10-18-15(19-14)12-2-1-7-17-9-12/h3-6,10,12,17H,1-2,7-9H2/t12-/m0/s1 |
| InChIKey | BPJBVYGPJGTISX-LBPRGKRZSA-N |
| XLogP | 3.39 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |