C12H13ClN2O — CID 43114866
5-chloro-2-piperidin-3-yl-1,3-benzoxazole (PubChem CID 43114866) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 5-chloro-2-piperidin-3-yl-1,3-benzoxazole.
| Compound Name | 5-chloro-2-piperidin-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 43114866 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 5-chloro-2-piperidin-3-yl-1,3-benzoxazole |
| SMILES | Clc1ccc2oc(C3CCCNC3)nc2c1 |
| InChI | InChI=1S/C12H13ClN2O/c13-9-3-4-11-10(6-9)15-12(16-11)8-2-1-5-14-7-8/h3-4,6,8,14H,1-2,5,7H2 |
| InChIKey | YKMCCRZABWAOGM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |