C9H13NO3 — CID 115016406
[5-(oxan-4-yl)-1,3-oxazol-2-yl]methanol (PubChem CID 115016406) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is [5-(oxan-4-yl)-1,3-oxazol-2-yl]methanol.
| Compound Name | [5-(oxan-4-yl)-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 115016406 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | [5-(oxan-4-yl)-1,3-oxazol-2-yl]methanol |
| SMILES | OCc1ncc(C2CCOCC2)o1 |
| InChI | InChI=1S/C9H13NO3/c11-6-9-10-5-8(13-9)7-1-3-12-4-2-7/h5,7,11H,1-4,6H2 |
| InChIKey | HCHXMFWAJJSHHR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |