C10H15NO3 — CID 115085348
[2-(oxan-4-ylmethyl)-1,3-oxazol-5-yl]methanol (PubChem CID 115085348) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is [2-(oxan-4-ylmethyl)-1,3-oxazol-5-yl]methanol.
| Compound Name | [2-(oxan-4-ylmethyl)-1,3-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 115085348 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | [2-(oxan-4-ylmethyl)-1,3-oxazol-5-yl]methanol |
| SMILES | OCc1cnc(CC2CCOCC2)o1 |
| InChI | InChI=1S/C10H15NO3/c12-7-9-6-11-10(14-9)5-8-1-3-13-4-2-8/h6,8,12H,1-5,7H2 |
| InChIKey | CJJDBYNDDKGCJW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |