C8H11NO2 — CID 165442391
[2-(cyclopropylmethyl)-1,3-oxazol-5-yl]methanol (PubChem CID 165442391) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is [2-(cyclopropylmethyl)-1,3-oxazol-5-yl]methanol.
| Compound Name | [2-(cyclopropylmethyl)-1,3-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 165442391 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | [2-(cyclopropylmethyl)-1,3-oxazol-5-yl]methanol |
| SMILES | OCc1cnc(CC2CC2)o1 |
| InChI | InChI=1S/C8H11NO2/c10-5-7-4-9-8(11-7)3-6-1-2-6/h4,6,10H,1-3,5H2 |
| InChIKey | BYTHSRWRQDLOAH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |