C11H10FNO2 — CID 115086766
[2-[(2-fluorophenyl)methyl]-1,3-oxazol-5-yl]methanol (PubChem CID 115086766) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl]-1,3-oxazol-5-yl]methanol.
| Compound Name | [2-[(2-fluorophenyl)methyl]-1,3-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 115086766 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl]-1,3-oxazol-5-yl]methanol |
| SMILES | OCc1cnc(Cc2ccccc2F)o1 |
| InChI | InChI=1S/C11H10FNO2/c12-10-4-2-1-3-8(10)5-11-13-6-9(7-14)15-11/h1-4,6,14H,5,7H2 |
| InChIKey | XHNWJGKZZYBVFN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |