C12H10ClNO2 — CID 115086804
2-[2-[(2-chlorophenyl)methyl]-1,3-oxazol-5-yl]acetaldehyde (PubChem CID 115086804) has the molecular formula C12H10ClNO2 and a molecular weight of 235.67 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methyl]-1,3-oxazol-5-yl]acetaldehyde.
| Compound Name | 2-[2-[(2-chlorophenyl)methyl]-1,3-oxazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115086804 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methyl]-1,3-oxazol-5-yl]acetaldehyde |
| SMILES | O=CCc1cnc(Cc2ccccc2Cl)o1 |
| InChI | InChI=1S/C12H10ClNO2/c13-11-4-2-1-3-9(11)7-12-14-8-10(16-12)5-6-15/h1-4,6,8H,5,7H2 |
| InChIKey | RJTNCUFVUSRKFW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|