C10H9NO3 — CID 115087564
2-[2-(furan-2-ylmethyl)-1,3-oxazol-5-yl]acetaldehyde (PubChem CID 115087564) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-[2-(furan-2-ylmethyl)-1,3-oxazol-5-yl]acetaldehyde.
| Compound Name | 2-[2-(furan-2-ylmethyl)-1,3-oxazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 115087564 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-[2-(furan-2-ylmethyl)-1,3-oxazol-5-yl]acetaldehyde |
| SMILES | O=CCc1cnc(Cc2ccco2)o1 |
| InChI | InChI=1S/C10H9NO3/c12-4-3-9-7-11-10(14-9)6-8-2-1-5-13-8/h1-2,4-5,7H,3,6H2 |
| InChIKey | HCXDEUCMLZKJAO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|