C8H6BrNOS — CID 117259797
2-bromo-5-(furan-2-ylmethyl)-1,3-thiazole (PubChem CID 117259797) has the molecular formula C8H6BrNOS and a molecular weight of 244.11 g/mol. Its IUPAC name is 2-bromo-5-(furan-2-ylmethyl)-1,3-thiazole.
| Compound Name | 2-bromo-5-(furan-2-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 117259797 |
| Molecular Formula | C8H6BrNOS |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 242.94 |
| IUPAC Name | 2-bromo-5-(furan-2-ylmethyl)-1,3-thiazole |
| SMILES | Brc1ncc(Cc2ccco2)s1 |
| InChI | InChI=1S/C8H6BrNOS/c9-8-10-5-7(12-8)4-6-2-1-3-11-6/h1-3,5H,4H2 |
| InChIKey | CHRFWQRXODQYNM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |