C8H7BrN2OS — CID 63383961
2-bromo-5-[2-(furan-2-yl)ethyl]-1,3,4-thiadiazole (PubChem CID 63383961) has the molecular formula C8H7BrN2OS and a molecular weight of 259.13 g/mol. Its IUPAC name is 2-bromo-5-[2-(furan-2-yl)ethyl]-1,3,4-thiadiazole.
| Compound Name | 2-bromo-5-[2-(furan-2-yl)ethyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63383961 |
| Molecular Formula | C8H7BrN2OS |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | 2-bromo-5-[2-(furan-2-yl)ethyl]-1,3,4-thiadiazole |
| SMILES | Brc1nnc(CCc2ccco2)s1 |
| InChI | InChI=1S/C8H7BrN2OS/c9-8-11-10-7(13-8)4-3-6-2-1-5-12-6/h1-2,5H,3-4H2 |
| InChIKey | AWWZSVRXAJDQNS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |