C6H3BrN2OS — CID 63383548
2-bromo-5-(furan-2-yl)-1,3,4-thiadiazole (PubChem CID 63383548) has the molecular formula C6H3BrN2OS and a molecular weight of 231.07 g/mol. Its IUPAC name is 2-bromo-5-(furan-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-bromo-5-(furan-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63383548 |
| Molecular Formula | C6H3BrN2OS |
| Molecular Weight | 231.07 g/mol |
| Exact Mass | 229.91 |
| IUPAC Name | 2-bromo-5-(furan-2-yl)-1,3,4-thiadiazole |
| SMILES | Brc1nnc(-c2ccco2)s1 |
| InChI | InChI=1S/C6H3BrN2OS/c7-6-9-8-5(11-6)4-2-1-3-10-4/h1-3H |
| InChIKey | IPLYNSLALHSKRC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.07 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |