C13H9ClN4O2S — CID 741055
1-(3-chlorophenyl)-3-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 741055) has the molecular formula C13H9ClN4O2S and a molecular weight of 320.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 741055 |
| Molecular Formula | C13H9ClN4O2S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nnc(-c2ccco2)s1 |
| InChI | InChI=1S/C13H9ClN4O2S/c14-8-3-1-4-9(7-8)15-12(19)16-13-18-17-11(21-13)10-5-2-6-20-10/h1-7H,(H2,15,16,18,19) |
| InChIKey | MZPNCNITHMAIGD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |