C9H9BrN2OS — CID 79400362
4-bromo-N-[2-(furan-2-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 79400362) has the molecular formula C9H9BrN2OS and a molecular weight of 273.16 g/mol. Its IUPAC name is 4-bromo-N-[2-(furan-2-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-bromo-N-[2-(furan-2-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79400362 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 4-bromo-N-[2-(furan-2-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | Brc1csc(NCCc2ccco2)n1 |
| InChI | InChI=1S/C9H9BrN2OS/c10-8-6-14-9(12-8)11-4-3-7-2-1-5-13-7/h1-2,5-6H,3-4H2,(H,11,12) |
| InChIKey | WMQLVEJESWLSAU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |