C14H11NO3S — CID 107470275
2-[2-(furan-2-yl)ethyl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 107470275) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)ethyl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[2-(furan-2-yl)ethyl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 107470275 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-[2-(furan-2-yl)ethyl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(CCc3ccco3)sc2c1 |
| InChI | InChI=1S/C14H11NO3S/c16-14(17)9-3-5-11-12(8-9)19-13(15-11)6-4-10-2-1-7-18-10/h1-3,5,7-8H,4,6H2,(H,16,17) |
| InChIKey | RDJASCPNJWTNPF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |