C8H8N2OS2 — CID 43243212
5-(furan-2-ylmethylsulfanyl)-1,3-thiazol-2-amine (PubChem CID 43243212) has the molecular formula C8H8N2OS2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-(furan-2-ylmethylsulfanyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(furan-2-ylmethylsulfanyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43243212 |
| Molecular Formula | C8H8N2OS2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 5-(furan-2-ylmethylsulfanyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(SCc2ccco2)s1 |
| InChI | InChI=1S/C8H8N2OS2/c9-8-10-4-7(13-8)12-5-6-2-1-3-11-6/h1-4H,5H2,(H2,9,10) |
| InChIKey | OZJPIXUGTHVGDR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |