C8H9N3O3S2 — CID 91812357
2-amino-N-(furan-2-ylmethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 91812357) has the molecular formula C8H9N3O3S2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-amino-N-(furan-2-ylmethyl)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-N-(furan-2-ylmethyl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 91812357 |
| Molecular Formula | C8H9N3O3S2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2-amino-N-(furan-2-ylmethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | Nc1ncc(S(=O)(=O)NCc2ccco2)s1 |
| InChI | InChI=1S/C8H9N3O3S2/c9-8-10-5-7(15-8)16(12,13)11-4-6-2-1-3-14-6/h1-3,5,11H,4H2,(H2,9,10) |
| InChIKey | ROWWLHQSTMVOTC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |