C9H10N2O3S2 — CID 91811051
N-(furan-2-ylmethyl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 91811051) has the molecular formula C9H10N2O3S2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 91811051 |
| Molecular Formula | C9H10N2O3S2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NCc2ccco2)s1 |
| InChI | InChI=1S/C9H10N2O3S2/c1-7-10-6-9(15-7)16(12,13)11-5-8-3-2-4-14-8/h2-4,6,11H,5H2,1H3 |
| InChIKey | JKZXKDOMBSZMCT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |