C8H13N3O2S2 — CID 103415343
N-[(E)-4-aminobut-2-enyl]-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103415343) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is N-[(E)-4-aminobut-2-enyl]-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[(E)-4-aminobut-2-enyl]-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103415343 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | N-[(E)-4-aminobut-2-enyl]-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NC/C=C/CN)s1 |
| InChI | InChI=1S/C8H13N3O2S2/c1-7-10-6-8(14-7)15(12,13)11-5-3-2-4-9/h2-3,6,11H,4-5,9H2,1H3/b3-2+ |
| InChIKey | PNYUIIGNMUNILH-NSCUHMNNSA-N |
| XLogP | 0.24 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|