C9H18ClN3O2S2 — CID 120716098
2-methyl-N-[2-(propylamino)ethyl]-1,3-thiazole-5-sulfonamide;hydrochloride (PubChem CID 120716098) has the molecular formula C9H18ClN3O2S2 and a molecular weight of 299.85 g/mol. Its IUPAC name is 2-methyl-N-[2-(propylamino)ethyl]-1,3-thiazole-5-sulfonamide;hydrochloride.
| Compound Name | 2-methyl-N-[2-(propylamino)ethyl]-1,3-thiazole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716098 |
| Molecular Formula | C9H18ClN3O2S2 |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-methyl-N-[2-(propylamino)ethyl]-1,3-thiazole-5-sulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1cnc(C)s1.Cl |
| InChI | InChI=1S/C9H17N3O2S2.ClH/c1-3-4-10-5-6-12-16(13,14)9-7-11-8(2)15-9;/h7,10,12H,3-6H2,1-2H3;1H |
| InChIKey | GMOMAMFHGZNALJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|