C8H14N2O3S2 — CID 103414895
N-(2-hydroxybutyl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103414895) has the molecular formula C8H14N2O3S2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N-(2-hydroxybutyl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(2-hydroxybutyl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103414895 |
| Molecular Formula | C8H14N2O3S2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | N-(2-hydroxybutyl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCC(O)CNS(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C8H14N2O3S2/c1-3-7(11)4-10-15(12,13)8-5-9-6(2)14-8/h5,7,10-11H,3-4H2,1-2H3 |
| InChIKey | VOPJKKNCHKTZQM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |