C11H19ClN2O2S2 — CID 114145871
N-[2-(2-chloroethyl)pentyl]-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 114145871) has the molecular formula C11H19ClN2O2S2 and a molecular weight of 310.87 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 114145871 |
| Molecular Formula | C11H19ClN2O2S2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCCC(CCCl)CNS(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C11H19ClN2O2S2/c1-3-4-10(5-6-12)7-14-18(15,16)11-8-13-9(2)17-11/h8,10,14H,3-7H2,1-2H3 |
| InChIKey | QABVKOVIHFUYHH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|